ethyl 4-(2-ethylanilino)-6,8-dimethylquinoline-3-carboxylate
Chemical Structure Depiction of
ethyl 4-(2-ethylanilino)-6,8-dimethylquinoline-3-carboxylate
ethyl 4-(2-ethylanilino)-6,8-dimethylquinoline-3-carboxylate
Compound characteristics
| Compound ID: | 4358-4434 |
| Compound Name: | ethyl 4-(2-ethylanilino)-6,8-dimethylquinoline-3-carboxylate |
| Molecular Weight: | 348.44 |
| Molecular Formula: | C22 H24 N2 O2 |
| Smiles: | CCc1ccccc1Nc1c(cnc2c(C)cc(C)cc12)C(=O)OCC |
| Stereo: | ACHIRAL |
| logP: | 6.0794 |
| logD: | 6.0788 |
| logSw: | -5.3636 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.434 |
| InChI Key: | NVDNLDXAFGBALK-UHFFFAOYSA-N |