3-[(4-chlorophenyl)methyl]-5-{[4-(methylsulfanyl)phenyl]methylidene}imidazolidine-2,4-dione
Chemical Structure Depiction of
3-[(4-chlorophenyl)methyl]-5-{[4-(methylsulfanyl)phenyl]methylidene}imidazolidine-2,4-dione
3-[(4-chlorophenyl)methyl]-5-{[4-(methylsulfanyl)phenyl]methylidene}imidazolidine-2,4-dione
Compound characteristics
| Compound ID: | 4371-5552 |
| Compound Name: | 3-[(4-chlorophenyl)methyl]-5-{[4-(methylsulfanyl)phenyl]methylidene}imidazolidine-2,4-dione |
| Molecular Weight: | 358.84 |
| Molecular Formula: | C18 H15 Cl N2 O2 S |
| Smiles: | CSc1ccc(/C=C2/C(N(Cc3ccc(cc3)[Cl])C(N2)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.6151 |
| logD: | 4.615 |
| logSw: | -4.9526 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.67 |
| InChI Key: | AFXFAYICYMXKNY-UHFFFAOYSA-N |