3-[(4-chlorophenyl)methyl]-5-({4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl}methylidene)imidazolidine-2,4-dione
Chemical Structure Depiction of
3-[(4-chlorophenyl)methyl]-5-({4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl}methylidene)imidazolidine-2,4-dione
3-[(4-chlorophenyl)methyl]-5-({4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl}methylidene)imidazolidine-2,4-dione
Compound characteristics
| Compound ID: | 4373-0137 |
| Compound Name: | 3-[(4-chlorophenyl)methyl]-5-({4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl}methylidene)imidazolidine-2,4-dione |
| Molecular Weight: | 466.9 |
| Molecular Formula: | C25 H20 Cl F N2 O4 |
| Smiles: | COc1cc(/C=C2/C(N(Cc3ccc(cc3)[Cl])C(N2)=O)=O)ccc1OCc1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 5.0643 |
| logD: | 5.0643 |
| logSw: | -5.4677 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.615 |
| InChI Key: | KTSAFZRBRHEFSI-UHFFFAOYSA-N |