2-{[2-(ethylsulfanyl)ethyl]sulfanyl}-4-phenyl-6-(thiophen-2-yl)pyridine-3-carbonitrile
Chemical Structure Depiction of
2-{[2-(ethylsulfanyl)ethyl]sulfanyl}-4-phenyl-6-(thiophen-2-yl)pyridine-3-carbonitrile
2-{[2-(ethylsulfanyl)ethyl]sulfanyl}-4-phenyl-6-(thiophen-2-yl)pyridine-3-carbonitrile
Compound characteristics
| Compound ID: | 4378-0291 |
| Compound Name: | 2-{[2-(ethylsulfanyl)ethyl]sulfanyl}-4-phenyl-6-(thiophen-2-yl)pyridine-3-carbonitrile |
| Molecular Weight: | 382.57 |
| Molecular Formula: | C20 H18 N2 S3 |
| Smiles: | CCSCCSc1c(C#N)c(cc(c2cccs2)n1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 6.3579 |
| logD: | 6.3579 |
| logSw: | -5.9449 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 26.5171 |
| InChI Key: | VODXYVHHOUHLEE-UHFFFAOYSA-N |