4-(3-chlorophenyl)-N-(3,4-difluorophenyl)-6-methyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Chemical Structure Depiction of
4-(3-chlorophenyl)-N-(3,4-difluorophenyl)-6-methyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide
4-(3-chlorophenyl)-N-(3,4-difluorophenyl)-6-methyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | 4383-0004 |
| Compound Name: | 4-(3-chlorophenyl)-N-(3,4-difluorophenyl)-6-methyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxamide |
| Molecular Weight: | 393.84 |
| Molecular Formula: | C18 H14 Cl F2 N3 O S |
| Smiles: | CC1=C(C(c2cccc(c2)[Cl])NC(N1)=S)C(Nc1ccc(c(c1)F)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0349 |
| logD: | 3.9545 |
| logSw: | -4.357 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 45.765 |
| InChI Key: | RZANXZKOYKUTDE-INIZCTEOSA-N |