2-cyano-3-(3-ethoxy-4-hydroxyphenyl)-N~1~-(4-phenyl-1,3-thiazol-2-yl)acrylamide
Chemical Structure Depiction of
2-cyano-3-(3-ethoxy-4-hydroxyphenyl)-N~1~-(4-phenyl-1,3-thiazol-2-yl)acrylamide
2-cyano-3-(3-ethoxy-4-hydroxyphenyl)-N~1~-(4-phenyl-1,3-thiazol-2-yl)acrylamide
Compound characteristics
| Compound ID: | 4384-0083 |
| Compound Name: | 2-cyano-3-(3-ethoxy-4-hydroxyphenyl)-N~1~-(4-phenyl-1,3-thiazol-2-yl)acrylamide |
| Molecular Weight: | 391.45 |
| Molecular Formula: | C21 H17 N3 O3 S |
| Smiles: | CCOc1cc(/C=C(/C#N)C(Nc2nc(cs2)c2ccccc2)=O)ccc1O |
| Stereo: | ACHIRAL |
| logP: | 4.76 |
| logD: | 4.75 |
| logSw: | -5.24 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 146.99 |
| InChI Key: | PDFKVRRXCLDUOR-UHFFFAOYSA-N |