2-cyano-3-[1-(2-phenoxyethyl)-1H-indol-3-yl]-N~1~-(4-phenyl-1,3-thiazol-2-yl)acrylamide
Chemical Structure Depiction of
2-cyano-3-[1-(2-phenoxyethyl)-1H-indol-3-yl]-N~1~-(4-phenyl-1,3-thiazol-2-yl)acrylamide
2-cyano-3-[1-(2-phenoxyethyl)-1H-indol-3-yl]-N~1~-(4-phenyl-1,3-thiazol-2-yl)acrylamide
Compound characteristics
| Compound ID: | 4384-0315 |
| Compound Name: | 2-cyano-3-[1-(2-phenoxyethyl)-1H-indol-3-yl]-N~1~-(4-phenyl-1,3-thiazol-2-yl)acrylamide |
| Molecular Weight: | 490.58 |
| Molecular Formula: | C29 H22 N4 O2 S |
| Smiles: | C(COc1ccccc1)n1cc(/C=C(/C#N)C(Nc2nc(cs2)c2ccccc2)=O)c2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 6.75 |
| logD: | 6.72 |
| logSw: | -7.32 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 104.92 |
| InChI Key: | GPVLGXZFAZZEPH-UHFFFAOYSA-N |