3-{4-[2-(4-allyl-2-methoxyphenoxy)ethoxy]-3-methoxyphenyl}-2-cyano-N~1~-(4-phenyl-1,3-thiazol-2-yl)acrylamide
Chemical Structure Depiction of
3-{4-[2-(4-allyl-2-methoxyphenoxy)ethoxy]-3-methoxyphenyl}-2-cyano-N~1~-(4-phenyl-1,3-thiazol-2-yl)acrylamide
3-{4-[2-(4-allyl-2-methoxyphenoxy)ethoxy]-3-methoxyphenyl}-2-cyano-N~1~-(4-phenyl-1,3-thiazol-2-yl)acrylamide
Compound characteristics
| Compound ID: | 4384-0351 |
| Compound Name: | 3-{4-[2-(4-allyl-2-methoxyphenoxy)ethoxy]-3-methoxyphenyl}-2-cyano-N~1~-(4-phenyl-1,3-thiazol-2-yl)acrylamide |
| Molecular Weight: | 567.66 |
| Molecular Formula: | C32 H29 N3 O5 S |
| Smiles: | COc1cc(CC=C)ccc1OCCOc1ccc(/C=C(/C#N)C(Nc2nc(cs2)c2ccccc2)=O)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 6.66 |
| logD: | 6.65 |
| logSw: | -7.29 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 136.73 |
| InChI Key: | USJROVCFWJNQQF-UHFFFAOYSA-N |