2-cyano-N~1~-(4-phenyl-1,3-thiazol-2-yl)-3-{5-[3-(trifluoromethyl)phenyl]-2-furyl}acrylamide
Chemical Structure Depiction of
2-cyano-N~1~-(4-phenyl-1,3-thiazol-2-yl)-3-{5-[3-(trifluoromethyl)phenyl]-2-furyl}acrylamide
2-cyano-N~1~-(4-phenyl-1,3-thiazol-2-yl)-3-{5-[3-(trifluoromethyl)phenyl]-2-furyl}acrylamide
Compound characteristics
| Compound ID: | 4384-0770 |
| Compound Name: | 2-cyano-N~1~-(4-phenyl-1,3-thiazol-2-yl)-3-{5-[3-(trifluoromethyl)phenyl]-2-furyl}acrylamide |
| Molecular Weight: | 465.45 |
| Molecular Formula: | C24 H14 F3 N3 O2 S |
| Smiles: | C(=C(/C#N)C(Nc1nc(cs1)c1ccccc1)=O)\c1ccc(c2cccc(c2)C(F)(F)F)o1 |
| Stereo: | ACHIRAL |
| logP: | 6.96 |
| logD: | 6.95 |
| logSw: | -7.82 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 104.06 |
| InChI Key: | BSCLLYDCBYAPMB-UHFFFAOYSA-N |