6-[2-(2,5-dimethoxyphenyl)-3-(4-fluorobenzoyl)-4-hydroxy-5-oxo-2,5-dihydro-1H-pyrrol-1-yl]hexanoic acid
					Chemical Structure Depiction of
6-[2-(2,5-dimethoxyphenyl)-3-(4-fluorobenzoyl)-4-hydroxy-5-oxo-2,5-dihydro-1H-pyrrol-1-yl]hexanoic acid
			6-[2-(2,5-dimethoxyphenyl)-3-(4-fluorobenzoyl)-4-hydroxy-5-oxo-2,5-dihydro-1H-pyrrol-1-yl]hexanoic acid
Compound characteristics
| Compound ID: | 4393-0018 | 
| Compound Name: | 6-[2-(2,5-dimethoxyphenyl)-3-(4-fluorobenzoyl)-4-hydroxy-5-oxo-2,5-dihydro-1H-pyrrol-1-yl]hexanoic acid | 
| Molecular Weight: | 471.48 | 
| Molecular Formula: | C25 H26 F N O7 | 
| Smiles: | COc1ccc(c(c1)C1C(=C(C(N1CCCCCC(O)=O)=O)O)C(c1ccc(cc1)F)=O)OC | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 3.0932 | 
| logD: | 0.265 | 
| logSw: | -3.2315 | 
| Hydrogen bond acceptors count: | 10 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 88.635 | 
| InChI Key: | BEPXUNBFNJBAJV-JOCHJYFZSA-N | 
 
				 
				