5-(2,6-dichloro-4-nitrophenyl)furan-2-carboxylic acid
Chemical Structure Depiction of
5-(2,6-dichloro-4-nitrophenyl)furan-2-carboxylic acid
5-(2,6-dichloro-4-nitrophenyl)furan-2-carboxylic acid
Compound characteristics
| Compound ID: | 4401-0005 |
| Compound Name: | 5-(2,6-dichloro-4-nitrophenyl)furan-2-carboxylic acid |
| Molecular Weight: | 302.07 |
| Molecular Formula: | C11 H5 Cl2 N O5 |
| Smiles: | c1cc(c2c(cc(cc2[Cl])[N+]([O-])=O)[Cl])oc1C(O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3798 |
| logD: | -2.408 |
| logSw: | -3.8359 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.427 |
| InChI Key: | BFXJURJPVKFDPR-UHFFFAOYSA-N |