3-chloro-N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-4-methylbenzamide
Chemical Structure Depiction of
3-chloro-N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-4-methylbenzamide
3-chloro-N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-4-methylbenzamide
Compound characteristics
| Compound ID: | 4402-0087 |
| Compound Name: | 3-chloro-N-[3-(5,7-dimethyl-1,3-benzoxazol-2-yl)phenyl]-4-methylbenzamide |
| Molecular Weight: | 390.87 |
| Molecular Formula: | C23 H19 Cl N2 O2 |
| Smiles: | Cc1cc(C)c2c(c1)nc(c1cccc(c1)NC(c1ccc(C)c(c1)[Cl])=O)o2 |
| Stereo: | ACHIRAL |
| logP: | 6.6868 |
| logD: | 6.6867 |
| logSw: | -6.5387 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.373 |
| InChI Key: | UBRLFJUWJXACDQ-UHFFFAOYSA-N |