N-[3-(1,3-benzoxazol-2-yl)-2-methylphenyl]-3-bromo-4-ethoxybenzamide
					Chemical Structure Depiction of
N-[3-(1,3-benzoxazol-2-yl)-2-methylphenyl]-3-bromo-4-ethoxybenzamide
			N-[3-(1,3-benzoxazol-2-yl)-2-methylphenyl]-3-bromo-4-ethoxybenzamide
Compound characteristics
| Compound ID: | 4402-0358 | 
| Compound Name: | N-[3-(1,3-benzoxazol-2-yl)-2-methylphenyl]-3-bromo-4-ethoxybenzamide | 
| Molecular Weight: | 451.32 | 
| Molecular Formula: | C23 H19 Br N2 O3 | 
| Smiles: | CCOc1ccc(cc1[Br])C(Nc1cccc(c1C)c1nc2ccccc2o1)=O | 
| Stereo: | ACHIRAL | 
| logP: | 5.8578 | 
| logD: | 5.8577 | 
| logSw: | -5.5172 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 46.652 | 
| InChI Key: | OMXHIYCXLMXAGJ-UHFFFAOYSA-N | 
 
				 
				