N-[3-(1,3-benzoxazol-2-yl)-2-methylphenyl]-2-(4-ethylphenoxy)acetamide
Chemical Structure Depiction of
N-[3-(1,3-benzoxazol-2-yl)-2-methylphenyl]-2-(4-ethylphenoxy)acetamide
N-[3-(1,3-benzoxazol-2-yl)-2-methylphenyl]-2-(4-ethylphenoxy)acetamide
Compound characteristics
| Compound ID: | 4402-0388 |
| Compound Name: | N-[3-(1,3-benzoxazol-2-yl)-2-methylphenyl]-2-(4-ethylphenoxy)acetamide |
| Molecular Weight: | 386.45 |
| Molecular Formula: | C24 H22 N2 O3 |
| Smiles: | CCc1ccc(cc1)OCC(Nc1cccc(c1C)c1nc2ccccc2o1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.62 |
| logD: | 5.62 |
| logSw: | -5.4618 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.728 |
| InChI Key: | SYKSDIMYSZNTHN-UHFFFAOYSA-N |