5-[(1-{4-[(4-chlorophenyl)methoxy]phenyl}-2,5-dimethyl-1H-pyrrol-3-yl)methylidene]imidazolidine-2,4-dione
Chemical Structure Depiction of
5-[(1-{4-[(4-chlorophenyl)methoxy]phenyl}-2,5-dimethyl-1H-pyrrol-3-yl)methylidene]imidazolidine-2,4-dione
5-[(1-{4-[(4-chlorophenyl)methoxy]phenyl}-2,5-dimethyl-1H-pyrrol-3-yl)methylidene]imidazolidine-2,4-dione
Compound characteristics
| Compound ID: | 4449-0524 |
| Compound Name: | 5-[(1-{4-[(4-chlorophenyl)methoxy]phenyl}-2,5-dimethyl-1H-pyrrol-3-yl)methylidene]imidazolidine-2,4-dione |
| Molecular Weight: | 421.88 |
| Molecular Formula: | C23 H20 Cl N3 O3 |
| Smiles: | Cc1cc(\C=C2/C(NC(N2)=O)=O)c(C)n1c1ccc(cc1)OCc1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.938 |
| logD: | 3.9374 |
| logSw: | -4.3978 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.204 |
| InChI Key: | ZNSCSFQYSIOXEP-UHFFFAOYSA-N |