3-[2-(2,4-dimethoxyphenyl)-2-oxoethyl]-3-hydroxy-1-(2-phenylethyl)-1,3-dihydro-2H-indol-2-one
Chemical Structure Depiction of
3-[2-(2,4-dimethoxyphenyl)-2-oxoethyl]-3-hydroxy-1-(2-phenylethyl)-1,3-dihydro-2H-indol-2-one
3-[2-(2,4-dimethoxyphenyl)-2-oxoethyl]-3-hydroxy-1-(2-phenylethyl)-1,3-dihydro-2H-indol-2-one
Compound characteristics
| Compound ID: | 4451-0054 |
| Compound Name: | 3-[2-(2,4-dimethoxyphenyl)-2-oxoethyl]-3-hydroxy-1-(2-phenylethyl)-1,3-dihydro-2H-indol-2-one |
| Molecular Weight: | 431.49 |
| Molecular Formula: | C26 H25 N O5 |
| Smiles: | COc1ccc(C(CC2(C(N(CCc3ccccc3)c3ccccc23)=O)O)=O)c(c1)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9169 |
| logD: | 3.9169 |
| logSw: | -4.1766 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.195 |
| InChI Key: | NNMXJERWDAAKOW-SANMLTNESA-N |