5,5-dimethyl-3-(4-methylphenyl)-5,6-dihydro[1,2,4]triazolo[3,4-a]isoquinoline
Chemical Structure Depiction of
5,5-dimethyl-3-(4-methylphenyl)-5,6-dihydro[1,2,4]triazolo[3,4-a]isoquinoline
5,5-dimethyl-3-(4-methylphenyl)-5,6-dihydro[1,2,4]triazolo[3,4-a]isoquinoline
Compound characteristics
| Compound ID: | 4459-0082 |
| Compound Name: | 5,5-dimethyl-3-(4-methylphenyl)-5,6-dihydro[1,2,4]triazolo[3,4-a]isoquinoline |
| Molecular Weight: | 289.38 |
| Molecular Formula: | C19 H19 N3 |
| Smiles: | Cc1ccc(cc1)c1nnc2c3ccccc3CC(C)(C)n12 |
| Stereo: | ACHIRAL |
| logP: | 4.3166 |
| logD: | 4.3166 |
| logSw: | -4.5566 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 24.1008 |
| InChI Key: | LFESZQRDPUZMOE-UHFFFAOYSA-N |