methyl (adamantan-1-yl)(3-chlorobenzamido)acetate
Chemical Structure Depiction of
methyl (adamantan-1-yl)(3-chlorobenzamido)acetate
methyl (adamantan-1-yl)(3-chlorobenzamido)acetate
Compound characteristics
| Compound ID: | 4462-5575 |
| Compound Name: | methyl (adamantan-1-yl)(3-chlorobenzamido)acetate |
| Molecular Weight: | 361.87 |
| Molecular Formula: | C20 H24 Cl N O3 |
| Smiles: | COC(C(C12CC3CC(CC(C3)C2)C1)NC(c1cccc(c1)[Cl])=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3718 |
| logD: | 4.3717 |
| logSw: | -4.6378 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.211 |
| InChI Key: | VAJGQKJOCALMSY-ANCGMVAHSA-N |