methyl N-[(benzyloxy)carbonyl]isoleucylphenylalaninate
Chemical Structure Depiction of
methyl N-[(benzyloxy)carbonyl]isoleucylphenylalaninate
methyl N-[(benzyloxy)carbonyl]isoleucylphenylalaninate
Compound characteristics
| Compound ID: | 4464-0967 |
| Compound Name: | methyl N-[(benzyloxy)carbonyl]isoleucylphenylalaninate |
| Molecular Weight: | 426.51 |
| Molecular Formula: | C24 H30 N2 O5 |
| Smiles: | CCC(C)C(C(NC(Cc1ccccc1)C(=O)OC)=O)NC(=O)OCc1ccccc1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.5374 |
| logD: | 4.5374 |
| logSw: | -4.5612 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 77.95 |
| InChI Key: | MNGJXXOGLLZAJR-UHFFFAOYSA-N |