2-[(4-methylanilino)methylidene]-5-phenylcyclohexane-1,3-dione
Chemical Structure Depiction of
2-[(4-methylanilino)methylidene]-5-phenylcyclohexane-1,3-dione
2-[(4-methylanilino)methylidene]-5-phenylcyclohexane-1,3-dione
Compound characteristics
| Compound ID: | 4466-0273 |
| Compound Name: | 2-[(4-methylanilino)methylidene]-5-phenylcyclohexane-1,3-dione |
| Molecular Weight: | 305.37 |
| Molecular Formula: | C20 H19 N O2 |
| Smiles: | Cc1ccc(cc1)NC=C1C(CC(CC1=O)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2942 |
| logD: | 4.2779 |
| logSw: | -4.3184 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.984 |
| InChI Key: | WUBPXZHMHIKILI-UHFFFAOYSA-N |