2-hydroxy-N'-(2-oxo-1,2-dihydro-3H-indol-3-ylidene)-2,2-diphenylacetohydrazide
Chemical Structure Depiction of
2-hydroxy-N'-(2-oxo-1,2-dihydro-3H-indol-3-ylidene)-2,2-diphenylacetohydrazide
2-hydroxy-N'-(2-oxo-1,2-dihydro-3H-indol-3-ylidene)-2,2-diphenylacetohydrazide
Compound characteristics
| Compound ID: | 4466-1039 |
| Compound Name: | 2-hydroxy-N'-(2-oxo-1,2-dihydro-3H-indol-3-ylidene)-2,2-diphenylacetohydrazide |
| Molecular Weight: | 371.39 |
| Molecular Formula: | C22 H17 N3 O3 |
| Smiles: | c1ccc(cc1)C(C(N/N=C1C(Nc2ccccc\12)=O)=O)(c1ccccc1)O |
| Stereo: | ACHIRAL |
| logP: | 2.9489 |
| logD: | 2.8153 |
| logSw: | -3.7219 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 74.161 |
| InChI Key: | VUYCLRUGCOCJDI-UHFFFAOYSA-N |