propan-2-yl 6-methyl-2-oxo-4-[4-(propan-2-yl)phenyl]-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Chemical Structure Depiction of
propan-2-yl 6-methyl-2-oxo-4-[4-(propan-2-yl)phenyl]-1,2,3,4-tetrahydropyrimidine-5-carboxylate
propan-2-yl 6-methyl-2-oxo-4-[4-(propan-2-yl)phenyl]-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | 4476-0572 |
| Compound Name: | propan-2-yl 6-methyl-2-oxo-4-[4-(propan-2-yl)phenyl]-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Molecular Weight: | 316.4 |
| Molecular Formula: | C18 H24 N2 O3 |
| Smiles: | CC(C)c1ccc(cc1)C1C(=C(C)NC(N1)=O)C(=O)OC(C)C |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3288 |
| logD: | 3.1785 |
| logSw: | -3.4441 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.124 |
| InChI Key: | OZZDRYZNUXMLDY-INIZCTEOSA-N |