dimethyl 2,6-dimethyl-4-[1-phenyl-3-(thiophen-2-yl)-1H-pyrazol-4-yl]-1,4-dihydropyridine-3,5-dicarboxylate
Chemical Structure Depiction of
dimethyl 2,6-dimethyl-4-[1-phenyl-3-(thiophen-2-yl)-1H-pyrazol-4-yl]-1,4-dihydropyridine-3,5-dicarboxylate
dimethyl 2,6-dimethyl-4-[1-phenyl-3-(thiophen-2-yl)-1H-pyrazol-4-yl]-1,4-dihydropyridine-3,5-dicarboxylate
Compound characteristics
| Compound ID: | 4476-1867 |
| Compound Name: | dimethyl 2,6-dimethyl-4-[1-phenyl-3-(thiophen-2-yl)-1H-pyrazol-4-yl]-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Weight: | 449.53 |
| Molecular Formula: | C24 H23 N3 O4 S |
| Smiles: | CC1=C(C(C(=C(C)N1)C(=O)OC)c1cn(c2ccccc2)nc1c1cccs1)C(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 4.2374 |
| logD: | 0.1885 |
| logSw: | -4.229 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.353 |
| InChI Key: | WSOTTZGZGAVSJU-UHFFFAOYSA-N |