N-{3-[(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)amino]-3-oxo-1-(thiophen-2-yl)prop-1-en-2-yl}benzamide
Chemical Structure Depiction of
N-{3-[(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)amino]-3-oxo-1-(thiophen-2-yl)prop-1-en-2-yl}benzamide
N-{3-[(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)amino]-3-oxo-1-(thiophen-2-yl)prop-1-en-2-yl}benzamide
Compound characteristics
| Compound ID: | 4476-2073 |
| Compound Name: | N-{3-[(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)amino]-3-oxo-1-(thiophen-2-yl)prop-1-en-2-yl}benzamide |
| Molecular Weight: | 458.54 |
| Molecular Formula: | C25 H22 N4 O3 S |
| Smiles: | [H]C(=C(/C(NC1=C(C)N(C)N(C1=O)c1ccccc1)=O)NC(c1ccccc1)=O)\c1cccs1 |
| Stereo: | ACHIRAL |
| logP: | 2.4008 |
| logD: | 0.7797 |
| logSw: | -2.7723 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.654 |
| InChI Key: | POOYHXOTLBDARO-UHFFFAOYSA-N |