di(prop-2-en-1-yl) 4-(4-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
Chemical Structure Depiction of
di(prop-2-en-1-yl) 4-(4-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
di(prop-2-en-1-yl) 4-(4-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
Compound characteristics
| Compound ID: | 4476-4948 |
| Compound Name: | di(prop-2-en-1-yl) 4-(4-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Weight: | 383.44 |
| Molecular Formula: | C22 H25 N O5 |
| Smiles: | CC1=C(C(C(=C(C)N1)C(=O)OCC=C)c1ccc(cc1)OC)C(=O)OCC=C |
| Stereo: | ACHIRAL |
| logP: | 3.4522 |
| logD: | -0.1612 |
| logSw: | -3.4345 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.993 |
| InChI Key: | IDQIWPYGXKMQDT-UHFFFAOYSA-N |