2-[(4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]-1-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]ethan-1-one
Chemical Structure Depiction of
2-[(4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]-1-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]ethan-1-one
2-[(4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]-1-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]ethan-1-one
Compound characteristics
| Compound ID: | 4477-1540 |
| Compound Name: | 2-[(4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]-1-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]ethan-1-one |
| Molecular Weight: | 426.5 |
| Molecular Formula: | C18 H13 F3 N2 O S3 |
| Smiles: | C1CSC(=N1)SCC(N1c2ccccc2Sc2ccc(cc12)C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0284 |
| logD: | 5.0283 |
| logSw: | -4.9782 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 23.056 |
| InChI Key: | BOWAPNJFFRIFOA-UHFFFAOYSA-N |