N-(3-chlorophenyl)-N'-{[(4,6-dimethylpyrimidin-2-yl)amino](2-methylanilino)methylidene}urea
Chemical Structure Depiction of
N-(3-chlorophenyl)-N'-{[(4,6-dimethylpyrimidin-2-yl)amino](2-methylanilino)methylidene}urea
N-(3-chlorophenyl)-N'-{[(4,6-dimethylpyrimidin-2-yl)amino](2-methylanilino)methylidene}urea
Compound characteristics
| Compound ID: | 4477-1855 |
| Compound Name: | N-(3-chlorophenyl)-N'-{[(4,6-dimethylpyrimidin-2-yl)amino](2-methylanilino)methylidene}urea |
| Molecular Weight: | 408.89 |
| Molecular Formula: | C21 H21 Cl N6 O |
| Smiles: | Cc1ccccc1N/C(Nc1nc(C)cc(C)n1)=N/C(Nc1cccc(c1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.3262 |
| logD: | 0.3273 |
| logSw: | -4.3919 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 68.361 |
| InChI Key: | BFFVGTOFVKTLOK-UHFFFAOYSA-N |