N~2~,N~4~-bis(4-methylphenyl)-6-[(4-methyl-4H-1,2,4-triazol-3-yl)sulfanyl]-1,3,5-triazine-2,4-diamine
Chemical Structure Depiction of
N~2~,N~4~-bis(4-methylphenyl)-6-[(4-methyl-4H-1,2,4-triazol-3-yl)sulfanyl]-1,3,5-triazine-2,4-diamine
N~2~,N~4~-bis(4-methylphenyl)-6-[(4-methyl-4H-1,2,4-triazol-3-yl)sulfanyl]-1,3,5-triazine-2,4-diamine
Compound characteristics
| Compound ID: | 4477-2884 |
| Compound Name: | N~2~,N~4~-bis(4-methylphenyl)-6-[(4-methyl-4H-1,2,4-triazol-3-yl)sulfanyl]-1,3,5-triazine-2,4-diamine |
| Molecular Weight: | 404.49 |
| Molecular Formula: | C20 H20 N8 S |
| Smiles: | Cc1ccc(cc1)Nc1nc(Nc2ccc(C)cc2)nc(n1)Sc1nncn1C |
| Stereo: | ACHIRAL |
| logP: | 5.6659 |
| logD: | 5.6652 |
| logSw: | -5.6727 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.414 |
| InChI Key: | IGNNNJQQECBXJO-UHFFFAOYSA-N |