[5-({3-[(2-fluorophenyl)methoxy]phenyl}methylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid
Chemical Structure Depiction of
[5-({3-[(2-fluorophenyl)methoxy]phenyl}methylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid
[5-({3-[(2-fluorophenyl)methoxy]phenyl}methylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid
Compound characteristics
| Compound ID: | 4482-4118 |
| Compound Name: | [5-({3-[(2-fluorophenyl)methoxy]phenyl}methylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| Molecular Weight: | 403.45 |
| Molecular Formula: | C19 H14 F N O4 S2 |
| Smiles: | C(C(O)=O)N1C(/C(=C\c2cccc(c2)OCc2ccccc2F)SC1=S)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7101 |
| logD: | -0.4089 |
| logSw: | -2.9589 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.325 |
| InChI Key: | IPUZEDZRHUASRQ-UHFFFAOYSA-N |