N-(2,5-dimethylphenyl)-N-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl]acetamide
Chemical Structure Depiction of
N-(2,5-dimethylphenyl)-N-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl]acetamide
N-(2,5-dimethylphenyl)-N-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl]acetamide
Compound characteristics
| Compound ID: | 4483-0579 |
| Compound Name: | N-(2,5-dimethylphenyl)-N-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl]acetamide |
| Molecular Weight: | 322.36 |
| Molecular Formula: | C19 H18 N2 O3 |
| Smiles: | CC(N(CN1C(c2ccccc2C1=O)=O)c1cc(C)ccc1C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4115 |
| logD: | 3.4115 |
| logSw: | -3.7872 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.974 |
| InChI Key: | DGVGFBPJLOYUPP-UHFFFAOYSA-N |