2-(4-methylphenyl)-2-oxoethyl 2-(3-chloro-4-methylphenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylate
Chemical Structure Depiction of
2-(4-methylphenyl)-2-oxoethyl 2-(3-chloro-4-methylphenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylate
2-(4-methylphenyl)-2-oxoethyl 2-(3-chloro-4-methylphenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylate
Compound characteristics
| Compound ID: | 4483-1860 |
| Compound Name: | 2-(4-methylphenyl)-2-oxoethyl 2-(3-chloro-4-methylphenyl)-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylate |
| Molecular Weight: | 447.87 |
| Molecular Formula: | C25 H18 Cl N O5 |
| Smiles: | Cc1ccc(cc1)C(COC(c1ccc2C(N(C(c2c1)=O)c1ccc(C)c(c1)[Cl])=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6327 |
| logD: | 5.6327 |
| logSw: | -5.9239 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 62.984 |
| InChI Key: | AKRWOZVAFMYVKX-UHFFFAOYSA-N |