2-(3-nitrophenyl)-2-oxoethyl 2-(diphenylcarbamoyl)benzoate
Chemical Structure Depiction of
2-(3-nitrophenyl)-2-oxoethyl 2-(diphenylcarbamoyl)benzoate
2-(3-nitrophenyl)-2-oxoethyl 2-(diphenylcarbamoyl)benzoate
Compound characteristics
| Compound ID: | 4483-1968 |
| Compound Name: | 2-(3-nitrophenyl)-2-oxoethyl 2-(diphenylcarbamoyl)benzoate |
| Molecular Weight: | 480.48 |
| Molecular Formula: | C28 H20 N2 O6 |
| Smiles: | C(C(c1cccc(c1)[N+]([O-])=O)=O)OC(c1ccccc1C(N(c1ccccc1)c1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.794 |
| logD: | 4.794 |
| logSw: | -5.0483 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 82.595 |
| InChI Key: | YUOJBWYGMDJKKC-UHFFFAOYSA-N |