2-(1,3-dioxooctahydro-2H-isoindol-2-yl)phenyl 4-chlorobenzoate
Chemical Structure Depiction of
2-(1,3-dioxooctahydro-2H-isoindol-2-yl)phenyl 4-chlorobenzoate
2-(1,3-dioxooctahydro-2H-isoindol-2-yl)phenyl 4-chlorobenzoate
Compound characteristics
| Compound ID: | 4483-2266 |
| Compound Name: | 2-(1,3-dioxooctahydro-2H-isoindol-2-yl)phenyl 4-chlorobenzoate |
| Molecular Weight: | 383.83 |
| Molecular Formula: | C21 H18 Cl N O4 |
| Smiles: | C1CCC2C(C1)C(N(C2=O)c1ccccc1OC(c1ccc(cc1)[Cl])=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.6639 |
| logD: | 3.6639 |
| logSw: | -4.416 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 49.236 |
| InChI Key: | FXAGMNAQEGMZBL-UHFFFAOYSA-N |