2-(4-methyl-3-nitrophenyl)-2-oxoethyl 4-(3-chloroanilino)-4-oxobutanoate
Chemical Structure Depiction of
2-(4-methyl-3-nitrophenyl)-2-oxoethyl 4-(3-chloroanilino)-4-oxobutanoate
2-(4-methyl-3-nitrophenyl)-2-oxoethyl 4-(3-chloroanilino)-4-oxobutanoate
Compound characteristics
| Compound ID: | 4483-3293 |
| Compound Name: | 2-(4-methyl-3-nitrophenyl)-2-oxoethyl 4-(3-chloroanilino)-4-oxobutanoate |
| Molecular Weight: | 404.81 |
| Molecular Formula: | C19 H17 Cl N2 O6 |
| Smiles: | Cc1ccc(cc1[N+]([O-])=O)C(COC(CCC(Nc1cccc(c1)[Cl])=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8274 |
| logD: | 3.8271 |
| logSw: | -4.3055 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 89.978 |
| InChI Key: | NMKFGUDQSDCGNN-UHFFFAOYSA-N |