2-methylpropyl 8-methyl-2-(4-methylphenyl)quinoline-4-carboxylate
Chemical Structure Depiction of
2-methylpropyl 8-methyl-2-(4-methylphenyl)quinoline-4-carboxylate
2-methylpropyl 8-methyl-2-(4-methylphenyl)quinoline-4-carboxylate
Compound characteristics
| Compound ID: | 4483-3576 |
| Compound Name: | 2-methylpropyl 8-methyl-2-(4-methylphenyl)quinoline-4-carboxylate |
| Molecular Weight: | 333.43 |
| Molecular Formula: | C22 H23 N O2 |
| Smiles: | CC(C)COC(c1cc(c2ccc(C)cc2)nc2c(C)cccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 6.8084 |
| logD: | 6.7651 |
| logSw: | -5.9442 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.1972 |
| InChI Key: | WRGAWFMLQPZFQS-UHFFFAOYSA-N |