ethyl 7-methyl-5-[4-(methylsulfanyl)phenyl]-3-oxo-2-[(thiophen-2-yl)methylidene]-2,3-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
Chemical Structure Depiction of
ethyl 7-methyl-5-[4-(methylsulfanyl)phenyl]-3-oxo-2-[(thiophen-2-yl)methylidene]-2,3-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
ethyl 7-methyl-5-[4-(methylsulfanyl)phenyl]-3-oxo-2-[(thiophen-2-yl)methylidene]-2,3-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate
Compound characteristics
| Compound ID: | 4489-4774 |
| Compound Name: | ethyl 7-methyl-5-[4-(methylsulfanyl)phenyl]-3-oxo-2-[(thiophen-2-yl)methylidene]-2,3-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| Molecular Weight: | 456.6 |
| Molecular Formula: | C22 H20 N2 O3 S3 |
| Smiles: | CCOC(C1C(c2ccc(cc2)SC)N2C(=NC=1C)SC(=C/c1cccs1)\C2=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8825 |
| logD: | 4.8825 |
| logSw: | -4.5612 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 46.766 |
| InChI Key: | ZWWCESCVUXVNGD-LJQANCHMSA-N |