N-(5-chloro-2-methylphenyl)-4-phenoxybutanamide
Chemical Structure Depiction of
N-(5-chloro-2-methylphenyl)-4-phenoxybutanamide
N-(5-chloro-2-methylphenyl)-4-phenoxybutanamide
Compound characteristics
| Compound ID: | 4491-1235 |
| Compound Name: | N-(5-chloro-2-methylphenyl)-4-phenoxybutanamide |
| Molecular Weight: | 303.79 |
| Molecular Formula: | C17 H18 Cl N O2 |
| Smiles: | Cc1ccc(cc1NC(CCCOc1ccccc1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.7207 |
| logD: | 3.7203 |
| logSw: | -3.9015 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.8361 |
| InChI Key: | SRTXZQGIVMKCMA-UHFFFAOYSA-N |