N,N-dibenzyl-N'-(prop-2-en-1-yl)thiourea
Chemical Structure Depiction of
N,N-dibenzyl-N'-(prop-2-en-1-yl)thiourea
N,N-dibenzyl-N'-(prop-2-en-1-yl)thiourea
Compound characteristics
| Compound ID: | 4492-0001 |
| Compound Name: | N,N-dibenzyl-N'-(prop-2-en-1-yl)thiourea |
| Molecular Weight: | 296.43 |
| Molecular Formula: | C18 H20 N2 S |
| Smiles: | C=CCNC(N(Cc1ccccc1)Cc1ccccc1)=S |
| Stereo: | ACHIRAL |
| logP: | 3.787 |
| logD: | 3.787 |
| logSw: | -4.0912 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 11.8631 |
| InChI Key: | IPNYWESNDBXTQP-UHFFFAOYSA-N |