N-benzyl-N-[(cyclohex-3-en-1-yl)methyl]-N'-cyclohexylthiourea
Chemical Structure Depiction of
N-benzyl-N-[(cyclohex-3-en-1-yl)methyl]-N'-cyclohexylthiourea
N-benzyl-N-[(cyclohex-3-en-1-yl)methyl]-N'-cyclohexylthiourea
Compound characteristics
| Compound ID: | 4492-0010 |
| Compound Name: | N-benzyl-N-[(cyclohex-3-en-1-yl)methyl]-N'-cyclohexylthiourea |
| Molecular Weight: | 342.55 |
| Molecular Formula: | C21 H30 N2 S |
| Smiles: | C1CCC(CC1)NC(N(CC1CCC=CC1)Cc1ccccc1)=S |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.9497 |
| logD: | 5.9497 |
| logSw: | -6.0228 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 11.6675 |
| InChI Key: | CUOWXQLKHLSLAL-LJQANCHMSA-N |