N-benzyl-N'-phenyl-N-(1-phenylethyl)thiourea
Chemical Structure Depiction of
N-benzyl-N'-phenyl-N-(1-phenylethyl)thiourea
N-benzyl-N'-phenyl-N-(1-phenylethyl)thiourea
Compound characteristics
| Compound ID: | 4492-0015 |
| Compound Name: | N-benzyl-N'-phenyl-N-(1-phenylethyl)thiourea |
| Molecular Weight: | 346.49 |
| Molecular Formula: | C22 H22 N2 S |
| Smiles: | CC(c1ccccc1)N(Cc1ccccc1)C(Nc1ccccc1)=S |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.5109 |
| logD: | 5.5109 |
| logSw: | -5.6514 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 9.7918 |
| InChI Key: | QKCYPDNGVTZYBY-SFHVURJKSA-N |