3-ethyl-2-[(2-methoxyphenyl)imino]-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide
					Chemical Structure Depiction of
3-ethyl-2-[(2-methoxyphenyl)imino]-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide
			3-ethyl-2-[(2-methoxyphenyl)imino]-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide
Compound characteristics
| Compound ID: | 4514-2051 | 
| Compound Name: | 3-ethyl-2-[(2-methoxyphenyl)imino]-4-oxo-N-(4-propoxyphenyl)-1,3-thiazinane-6-carboxamide | 
| Molecular Weight: | 441.55 | 
| Molecular Formula: | C23 H27 N3 O4 S | 
| Smiles: | CCCOc1ccc(cc1)NC(C1CC(N(CC)/C(=N/c2ccccc2OC)S1)=O)=O | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 4.2206 | 
| logD: | 4.2204 | 
| logSw: | -4.1369 | 
| Hydrogen bond acceptors count: | 8 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 62.485 | 
| InChI Key: | SZTABWDYXFWMNF-FQEVSTJZSA-N | 
 
				 
				