methyl 1-chloro-4-(2,4-dichlorophenyl)-2-[(2-nitrophenyl)sulfanyl]-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylate
Chemical Structure Depiction of
methyl 1-chloro-4-(2,4-dichlorophenyl)-2-[(2-nitrophenyl)sulfanyl]-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylate
methyl 1-chloro-4-(2,4-dichlorophenyl)-2-[(2-nitrophenyl)sulfanyl]-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylate
Compound characteristics
| Compound ID: | 4523-0035 |
| Compound Name: | methyl 1-chloro-4-(2,4-dichlorophenyl)-2-[(2-nitrophenyl)sulfanyl]-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[c]quinoline-6-carboxylate |
| Molecular Weight: | 563.89 |
| Molecular Formula: | C26 H21 Cl3 N2 O4 S |
| Smiles: | COC(c1cccc2C3C(CC(C3[Cl])Sc3ccccc3[N+]([O-])=O)C(c3ccc(cc3[Cl])[Cl])Nc12)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 7.5647 |
| logD: | 7.5647 |
| logSw: | -6.3938 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.052 |
| InChI Key: | POIMRNZXDNXRME-UHFFFAOYSA-N |