5-(2-methoxyphenyl)-3-(4-nitrophenyl)-1,2,4-oxadiazole
Chemical Structure Depiction of
5-(2-methoxyphenyl)-3-(4-nitrophenyl)-1,2,4-oxadiazole
5-(2-methoxyphenyl)-3-(4-nitrophenyl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | 4534-1119 |
| Compound Name: | 5-(2-methoxyphenyl)-3-(4-nitrophenyl)-1,2,4-oxadiazole |
| Molecular Weight: | 297.27 |
| Molecular Formula: | C15 H11 N3 O4 |
| Smiles: | COc1ccccc1c1nc(c2ccc(cc2)[N+]([O-])=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 3.8148 |
| logD: | 3.8148 |
| logSw: | -4.1738 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 72.656 |
| InChI Key: | VIMZNTGNBBTJJE-UHFFFAOYSA-N |