3-(4-nitrophenyl)-5-(thiophen-2-yl)-1,2,4-oxadiazole
Chemical Structure Depiction of
3-(4-nitrophenyl)-5-(thiophen-2-yl)-1,2,4-oxadiazole
3-(4-nitrophenyl)-5-(thiophen-2-yl)-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | 4534-1866 |
| Compound Name: | 3-(4-nitrophenyl)-5-(thiophen-2-yl)-1,2,4-oxadiazole |
| Molecular Weight: | 273.27 |
| Molecular Formula: | C12 H7 N3 O3 S |
| Smiles: | c1cc(c2nc(c3ccc(cc3)[N+]([O-])=O)no2)sc1 |
| Stereo: | ACHIRAL |
| logP: | 3.9196 |
| logD: | 3.9196 |
| logSw: | -4.2832 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 66.044 |
| InChI Key: | RNBDDVSNTYIAEV-UHFFFAOYSA-N |