N-(2-methoxydibenzo[b,d]furan-3-yl)-4-methyl-3-nitrobenzamide
Chemical Structure Depiction of
N-(2-methoxydibenzo[b,d]furan-3-yl)-4-methyl-3-nitrobenzamide
N-(2-methoxydibenzo[b,d]furan-3-yl)-4-methyl-3-nitrobenzamide
Compound characteristics
| Compound ID: | 4534-4143 |
| Compound Name: | N-(2-methoxydibenzo[b,d]furan-3-yl)-4-methyl-3-nitrobenzamide |
| Molecular Weight: | 376.37 |
| Molecular Formula: | C21 H16 N2 O5 |
| Smiles: | Cc1ccc(cc1[N+]([O-])=O)C(Nc1cc2c(cc1OC)c1ccccc1o2)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2545 |
| logD: | 5.2333 |
| logSw: | -5.3801 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.258 |
| InChI Key: | LEAZZHIYDPJSQA-UHFFFAOYSA-N |