8-{2-[(2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl}-3-methyl-7-(2-methylpropyl)-3,7-dihydro-1H-purine-2,6-dione
Chemical Structure Depiction of
8-{2-[(2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl}-3-methyl-7-(2-methylpropyl)-3,7-dihydro-1H-purine-2,6-dione
8-{2-[(2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl}-3-methyl-7-(2-methylpropyl)-3,7-dihydro-1H-purine-2,6-dione
Compound characteristics
| Compound ID: | 4550-0205 |
| Compound Name: | 8-{2-[(2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl}-3-methyl-7-(2-methylpropyl)-3,7-dihydro-1H-purine-2,6-dione |
| Molecular Weight: | 386.41 |
| Molecular Formula: | C18 H22 N6 O4 |
| Smiles: | CC(C)Cn1c2C(NC(N(C)c2nc1N/N=C/c1ccc(cc1O)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4954 |
| logD: | 3.4934 |
| logSw: | -3.5728 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 99.026 |
| InChI Key: | CZJJVEPYONIJGE-UHFFFAOYSA-N |