ethyl 4-{[(2-{[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino}-2-oxoethyl)sulfanyl]acetyl}piperazine-1-carboxylate
Chemical Structure Depiction of
ethyl 4-{[(2-{[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino}-2-oxoethyl)sulfanyl]acetyl}piperazine-1-carboxylate
ethyl 4-{[(2-{[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino}-2-oxoethyl)sulfanyl]acetyl}piperazine-1-carboxylate
Compound characteristics
| Compound ID: | 4556-0961 |
| Compound Name: | ethyl 4-{[(2-{[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]amino}-2-oxoethyl)sulfanyl]acetyl}piperazine-1-carboxylate |
| Molecular Weight: | 478.59 |
| Molecular Formula: | C21 H26 N4 O5 S2 |
| Smiles: | CCOC(N1CCN(CC1)C(CSCC(Nc1nc(cs1)c1ccc(cc1)OC)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4627 |
| logD: | 3.4627 |
| logSw: | -3.577 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.607 |
| InChI Key: | FHHPCRHDVNUTHI-UHFFFAOYSA-N |