ethyl 4-{[(2-{[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino}-2-oxoethyl)sulfanyl]acetyl}piperazine-1-carboxylate
Chemical Structure Depiction of
ethyl 4-{[(2-{[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino}-2-oxoethyl)sulfanyl]acetyl}piperazine-1-carboxylate
ethyl 4-{[(2-{[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino}-2-oxoethyl)sulfanyl]acetyl}piperazine-1-carboxylate
Compound characteristics
| Compound ID: | 4556-1129 |
| Compound Name: | ethyl 4-{[(2-{[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]amino}-2-oxoethyl)sulfanyl]acetyl}piperazine-1-carboxylate |
| Molecular Weight: | 506.64 |
| Molecular Formula: | C23 H30 N4 O5 S2 |
| Smiles: | CCOC(N1CCN(CC1)C(CSCC(Nc1nc(c2ccc(cc2)OCC)c(C)s1)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7433 |
| logD: | 3.7431 |
| logSw: | -3.8153 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.958 |
| InChI Key: | AGJIOIYHTUBAKF-UHFFFAOYSA-N |