N~2~-(benzenesulfonyl)-N~2~-[2-chloro-5-(trifluoromethyl)phenyl]-N-ethylglycinamide
Chemical Structure Depiction of
N~2~-(benzenesulfonyl)-N~2~-[2-chloro-5-(trifluoromethyl)phenyl]-N-ethylglycinamide
N~2~-(benzenesulfonyl)-N~2~-[2-chloro-5-(trifluoromethyl)phenyl]-N-ethylglycinamide
Compound characteristics
| Compound ID: | 4567-0712 |
| Compound Name: | N~2~-(benzenesulfonyl)-N~2~-[2-chloro-5-(trifluoromethyl)phenyl]-N-ethylglycinamide |
| Molecular Weight: | 420.84 |
| Molecular Formula: | C17 H16 Cl F3 N2 O3 S |
| Smiles: | CCNC(CN(c1cc(ccc1[Cl])C(F)(F)F)S(c1ccccc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3728 |
| logD: | 3.3728 |
| logSw: | -3.796 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.86 |
| InChI Key: | DFFFXZNBMCLCHW-UHFFFAOYSA-N |