2-chloroethyl {4-methyl-2-[(4-methylbenzene-1-sulfonyl)amino]-1,3-thiazol-5-yl}carbamate
Chemical Structure Depiction of
2-chloroethyl {4-methyl-2-[(4-methylbenzene-1-sulfonyl)amino]-1,3-thiazol-5-yl}carbamate
2-chloroethyl {4-methyl-2-[(4-methylbenzene-1-sulfonyl)amino]-1,3-thiazol-5-yl}carbamate
Compound characteristics
| Compound ID: | 4576-0024 |
| Compound Name: | 2-chloroethyl {4-methyl-2-[(4-methylbenzene-1-sulfonyl)amino]-1,3-thiazol-5-yl}carbamate |
| Molecular Weight: | 389.88 |
| Molecular Formula: | C14 H16 Cl N3 O4 S2 |
| Smiles: | [H]N(C(=O)OCC[Cl])c1c(C)nc(N([H])S(c2ccc(C)cc2)(=O)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 3.2101 |
| logD: | 1.3858 |
| logSw: | -3.53 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 82.025 |
| InChI Key: | CZNVCLKSSVUTBI-UHFFFAOYSA-N |